5-Chlorotryptophan structure
|
Common Name | 5-Chlorotryptophan | ||
|---|---|---|---|---|
| CAS Number | 154-07-4 | Molecular Weight | 238.670 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 476.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.2±28.7 °C | |
| Name | (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 476.9±45.0 °C at 760 mmHg |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.670 |
| Flash Point | 242.2±28.7 °C |
| Exact Mass | 238.050903 |
| PSA | 79.11000 |
| LogP | 1.82 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.702 |
| InChIKey | TUKKZLIDCNWKIN-UHFFFAOYSA-N |
| SMILES | NC(Cc1c[nH]c2ccc(Cl)cc12)C(=O)O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Chlor-DL-tryptophan |
| 5-Chlorotryptophan |
| D,L-5-chlorotryptophan |
| 5-CHLOROBENZTRIAZOLE |
| Tryptophan, 5-chloro- |
| 5-chloro-1h-benzotriazol |
| 5-chloro-1H-Benzotriazole |
| 6-Chloro-1H-benzotriazole |
| 5-Cl-Trp-OH |
| 1H-Benzotriazole,5-chloro |
| 5-Chloro-1,2,3-benzotriazole |
| 5-chloro-DL-tryptophan |
| 5-Cl-benzotriazole |