5-Chlorotryptophan
5-Chlorotryptophan structure
|
Common Name | 5-Chlorotryptophan | ||
|---|---|---|---|---|
| CAS Number | 154-07-4 | Molecular Weight | 238.670 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 476.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.2±28.7 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 476.9±45.0 °C at 760 mmHg |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.670 |
| Flash Point | 242.2±28.7 °C |
| Exact Mass | 238.050903 |
| PSA | 79.11000 |
| LogP | 1.82 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.702 |
| InChIKey | TUKKZLIDCNWKIN-UHFFFAOYSA-N |
| SMILES | NC(Cc1c[nH]c2ccc(Cl)cc12)C(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-Chlor-DL-tryptophan |
| 5-Chlorotryptophan |
| D,L-5-chlorotryptophan |
| 5-CHLOROBENZTRIAZOLE |
| 5-chloro-1h-benzotriazol |
| 5-chloro-1H-Benzotriazole |
| 6-Chloro-1H-benzotriazole |
| 5-Cl-Trp-OH |
| 1H-Benzotriazole,5-chloro |
| 5-Chloro-1,2,3-benzotriazole |
| 5-chloro-DL-tryptophan |
| 5-Cl-benzotriazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine? |
| A: InChIKey of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine is TUKKZLIDCNWKIN-UHFFFAOYSA-N. |
| Q: What is the LogP of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine? |
| A: LogP of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine is 1.82. |
| Q: What is the CAS number of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine? |
| A: CAS number of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine is 154-07-4. |
| Q: What is the polar surface area (PSA) of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine? |
| A: Polar surface area (PSA) of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine is 79.11000. |
| Q: What is the molecular formula of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine? |
| A: Molecular formula of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine is C11H11ClN2O2. |
| Q: What is the boiling point of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine? |
| A: Boiling point of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine is 476.9±45.0 °C at 760 mmHg. |
| Q: What is the English name of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine? |
| A: The English name of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine is (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine. |
| Q: What is the molecular weight of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine? |
| A: Molecular weight of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine is 238.670. |
| Q: What is the SMILES notation of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine? |
| A: SMILES notation of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine is NC(Cc1c[nH]c2ccc(Cl)cc12)C(=O)O. |
| Q: What English synonyms does (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine have? |
| A: English synonyms of (2r)-3,6-dimethoxy-2-(1-methylethyl)-2,5-dihydropyrazine: 5-Chlor-DL-tryptophan, 5-Chlorotryptophan, D,L-5-chlorotryptophan, 5-CHLOROBENZTRIAZOLE, 5-chloro-1h-benzotriazol, 5-chloro-1H-Benzotriazole, 6-Chloro-1H-benzotriazole, 5-Cl-Trp-OH, 1H-Benzotriazole,5-chloro, 5-Chloro-1,2,3-benzotriazole, 5-chloro-DL-tryptophan, 5-Cl-benzotriazole. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |