2,3-Dihydroxy-6H-benzofuro[3,2-c][1]benzopyran-6-one structure
|
Common Name | 2,3-Dihydroxy-6H-benzofuro[3,2-c][1]benzopyran-6-one | ||
|---|---|---|---|---|
| CAS Number | 15402-22-9 | Molecular Weight | 284.22000 | |
| Density | 1.714g/cm3 | Boiling Point | 456.7ºC at 760mmHg | |
| Molecular Formula | C15H8O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230ºC | |
| Name | 2,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.714g/cm3 |
|---|---|
| Boiling Point | 456.7ºC at 760mmHg |
| Molecular Formula | C15H8O6 |
| Molecular Weight | 284.22000 |
| Flash Point | 230ºC |
| Exact Mass | 284.03200 |
| PSA | 104.04000 |
| LogP | 2.80920 |
| Vapour Pressure | 5.82E-09mmHg at 25°C |
| Index of Refraction | 1.806 |
| InChIKey | CJPXZAMCIOOMNF-UHFFFAOYSA-N |
| SMILES | O=c1oc2cc(O)c(O)cc2c2oc3cc(O)ccc3c12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Lucernol |
| 2,3,9-Trihydroxycoumestan |
| 6H-Benzofuro(3,2-c)(1)benzopyran-6-one,2,3,9-trihydroxy |
| 2,3,9-Trihydroxy-6H-benzofuro(3,2-c)(1)benzopyran-6-one |