33DICARBOMETHOXYBENZIDINE structure
|
Common Name | 33DICARBOMETHOXYBENZIDINE | ||
|---|---|---|---|---|
| CAS Number | 15403-45-9 | Molecular Weight | 300.30900 | |
| Density | 1.277g/cm3 | Boiling Point | 478.7ºC at 760 mmHg | |
| Molecular Formula | C16H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.1ºC | |
| Name | methyl 2-amino-5-(4-amino-3-methoxycarbonylphenyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 478.7ºC at 760 mmHg |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.30900 |
| Flash Point | 217.1ºC |
| Exact Mass | 300.11100 |
| PSA | 104.64000 |
| LogP | 3.25360 |
| Vapour Pressure | 2.51E-09mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | RSSUDYOKPAZOGO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(-c2ccc(N)c(C(=O)OC)c2)ccc1N |
| HS Code | 2922499990 |
|---|
|
~21%
33DICARBOMETHOX... CAS#:15403-45-9 |
| Literature: You; Brezzell; Das; Espadas-Torre; Hooberman; Sinsheimer Mutation Research - Genetic Toxicology Testing and Biomonitoring of Environmental or Occupational Exposure, 1993 , vol. 319, # 1 p. 19 - 30 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3,3'-Dicarbomethoxybenzidine |
| Dimethyl 4,4'-diamino-3,3'-biphenylylenedicarboxylate |
| Benzidin-3,3'-dicarbonsaeuredimethylester |
| Dimethyl 4,4'-diamino-(1,1'-biphenyl)-3,3'-dicarboxylate |
| (1,1'-Biphenyl)-3,3'-dicarboxylic acid,4,4'-diamino-,dimethyl ester |