2-[1-hydroxy-3,6,7-trimethoxy-9-oxo-8-(2-oxoethyl)xanthen-2-yl]acetaldehyde structure
|
Common Name | 2-[1-hydroxy-3,6,7-trimethoxy-9-oxo-8-(2-oxoethyl)xanthen-2-yl]acetaldehyde | ||
|---|---|---|---|---|
| CAS Number | 15404-78-1 | Molecular Weight | 386.35200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[1-hydroxy-3,6,7-trimethoxy-9-oxo-8-(2-oxoethyl)xanthen-2-yl]acetaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H18O8 |
|---|---|
| Molecular Weight | 386.35200 |
| Exact Mass | 386.10000 |
| PSA | 112.27000 |
| LogP | 2.16040 |
| InChIKey | JXJIJGFAPRIHIK-UHFFFAOYSA-N |
| SMILES | COc1cc2oc3cc(OC)c(OC)c(CC=O)c3c(=O)c2c(O)c1CC=O |
|
~%
2-[1-hydroxy-3,... CAS#:15404-78-1 |
| Literature: Yates; Stout Journal of the American Chemical Society, 1958 , vol. 80, p. 1691,1699 |
|
~%
2-[1-hydroxy-3,... CAS#:15404-78-1 |
| Literature: Yates; Stout Journal of the American Chemical Society, 1958 , vol. 80, p. 1691,1699 |
| 1-hydroxy-3,6,7-trimethoxy-2,8-bis-(2-oxo-ethyl)-xanthen-9-one |
| 9H-Xanthene-1,7-diacetaldehyde,8-hydroxy-2,3,6-trimethoxy-9-oxo |
| 1-Hydroxy-3,6,7-trimethoxy-2,8-bis-(2-oxo-aethyl)-xanthen-9-on |