N'-(1,3,3-Trimethylnorbornan-2-ylidene)isonicotinic hydrazide structure
|
Common Name | N'-(1,3,3-Trimethylnorbornan-2-ylidene)isonicotinic hydrazide | ||
|---|---|---|---|---|
| CAS Number | 15407-86-0 | Molecular Weight | 271.35700 | |
| Density | 1.21g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H21N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(Z)-(2,2,4-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridine-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.35700 |
| Exact Mass | 271.16800 |
| PSA | 54.35000 |
| LogP | 3.40450 |
| Index of Refraction | 1.624 |
| InChIKey | UBGJKRBQTVFLFD-XMHGGMMESA-N |
| SMILES | CC12CCC(C1)C(C)(C)C2=NNC(=O)c1ccncc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ISONICOTINIC ACID,(1,3,3-TRIMETHYL-2-NORBORNYLIDENE)HYDRAZIDE |
| 1,3,3-Trimethyl-2-isonicotinoylhydrazono-bicyclo[2.2.1]heptan |
| (1,3,3-Trimethyl-2-norbornylidene)hydrazide of isonicotinic acid |