Acetamide,N-[(4-chlorophenyl)methyl]-2-(3,4-dichlorophenoxy)- structure
|
Common Name | Acetamide,N-[(4-chlorophenyl)methyl]-2-(3,4-dichlorophenoxy)- | ||
|---|---|---|---|---|
| CAS Number | 15422-29-4 | Molecular Weight | 344.62000 | |
| Density | 1.384g/cm3 | Boiling Point | 546.8ºC at 760 mmHg | |
| Molecular Formula | C15H12Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.5ºC | |
| Name | N-[(4-chlorophenyl)methyl]-2-(3,4-dichlorophenoxy)acetamide |
|---|
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 546.8ºC at 760 mmHg |
| Molecular Formula | C15H12Cl3NO2 |
| Molecular Weight | 344.62000 |
| Flash Point | 284.5ºC |
| Exact Mass | 342.99300 |
| PSA | 38.33000 |
| LogP | 4.73290 |
| Vapour Pressure | 5.17E-12mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | ZXWGSLODLGNSKG-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc(Cl)c(Cl)c1)NCc1ccc(Cl)cc1 |
|
~%
Acetamide,N-[(4... CAS#:15422-29-4 |
| Literature: Baker,B.R.; Hurlbut,J.A. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 1129 - 1133 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |