1,2-bis[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]guanidine structure
|
Common Name | 1,2-bis[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]guanidine | ||
|---|---|---|---|---|
| CAS Number | 15427-80-2 | Molecular Weight | 407.47600 | |
| Density | 1.39g/cm3 | Boiling Point | 683.5ºC at 760mmHg | |
| Molecular Formula | C19H25N11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 367.2ºC | |
| Name | 1,2-bis[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]guanidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 683.5ºC at 760mmHg |
| Molecular Formula | C19H25N11 |
| Molecular Weight | 407.47600 |
| Flash Point | 367.2ºC |
| Exact Mass | 407.22900 |
| PSA | 196.43000 |
| LogP | 4.18710 |
| Vapour Pressure | 1.55E-18mmHg at 25°C |
| Index of Refraction | 1.698 |
| InChIKey | RNWNCGQQXMEMMQ-NXMZODBASA-N |
| SMILES | CC(=NN=C(N)N)c1ccc(N=C(N)Nc2ccc(C(C)=NN=C(N)N)cc2)cc1 |
| Bisguanylhydrazone of N,N'-[1,3-Bis-(4-acetylphenyl)-guanidine |