Ethyl 6,7-difluoro-2-ethylmercapto-4-hydroxyquinoline-3-carboxylate structure
|
Common Name | Ethyl 6,7-difluoro-2-ethylmercapto-4-hydroxyquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 154330-67-3 | Molecular Weight | 313.32000 | |
| Density | 1.38g/cm3 | Boiling Point | 402.7ºC at 760mmHg | |
| Molecular Formula | C14H13F2NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.4ºC | |
| Name | Ethyl 6,7-difluoro-2-ethylmercapto-4-hydroxyquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 402.7ºC at 760mmHg |
| Molecular Formula | C14H13F2NO3S |
| Molecular Weight | 313.32000 |
| Flash Point | 197.4ºC |
| Exact Mass | 313.05800 |
| PSA | 84.72000 |
| LogP | 3.50730 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | YKHPMXCEZRZUGN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(SCC)[nH]c2cc(F)c(F)cc2c1=O |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Prulifloxacin InterMediate PL-7 |