1,1'-isopropylidenebis[4-(1,1,2,2-tetrafluoroethoxy)benzene] structure
|
Common Name | 1,1'-isopropylidenebis[4-(1,1,2,2-tetrafluoroethoxy)benzene] | ||
|---|---|---|---|---|
| CAS Number | 1544-19-0 | Molecular Weight | 428.31600 | |
| Density | 1.305g/cm3 | Boiling Point | 379.9ºC at 760mmHg | |
| Molecular Formula | C19H16F8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.1ºC | |
| Name | 1-(1,1,2,2-tetrafluoroethoxy)-4-[2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.305g/cm3 |
|---|---|
| Boiling Point | 379.9ºC at 760mmHg |
| Molecular Formula | C19H16F8O2 |
| Molecular Weight | 428.31600 |
| Flash Point | 192.1ºC |
| Exact Mass | 428.10200 |
| PSA | 18.46000 |
| LogP | 6.48590 |
| Vapour Pressure | 1.24E-05mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | NILNWNGNABYYHH-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(OC(F)(F)C(F)F)cc1)c1ccc(OC(F)(F)C(F)F)cc1 |
|
~90%
1,1'-isopropyli... CAS#:1544-19-0 |
| Literature: Fukui, Hiroyuki; Murata, Hiroshi; Sanechika, Ken-Ichi; Ikeda, Masanori Journal of Fluorine Chemistry, 2000 , vol. 103, # 2 p. 129 - 134 |
| 1,1'-Isopropylidenebis(4-(1,1,2,2-tetrafluoroethoxy)benzene) |
| 2,2-Bis[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propane |
| 2,2-Bis-(4-hydroxy-phenyl)-propan-bis-(1,1,2,2-tetrafluor-ethylether) |
| 2,2-bis[p-(1,1,2,2-tetrafluoroethoxy)phenyl]propane |