3-(m-Chlorophenyl)-1,1-dipropylurea
Modify Date: 2025-08-26 08:09:13
3-(m-Chlorophenyl)-1,1-dipropylurea structure
|
Common Name | 3-(m-Chlorophenyl)-1,1-dipropylurea | ||
|---|---|---|---|---|
| CAS Number | 15441-99-3 | Molecular Weight | 254.75600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3-chlorophenyl)-1,1-dipropylurea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H19ClN2O |
|---|---|
| Molecular Weight | 254.75600 |
| Exact Mass | 254.11900 |
| PSA | 35.83000 |
| LogP | 4.00750 |
| InChIKey | BJRYHLJYGXKHCN-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C(=O)Nc1cccc(Cl)c1 |
| HS Code | 2924299090 |
|---|
|
~%
3-(m-Chlorophen... CAS#:15441-99-3 |
| Literature: Mido, Yoshiyuki; Furusawa, Chizuko Journal of Molecular Structure, 1982 , vol. 82, p. 23 - 28 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-(3-chlorophenyl)-3,3-dipropylurea |
| 3-(m-Chlorophenyl)-1,1-dipropylurea |
| N'-(3-Chlor-phenyl)-N,N-dipropyl-harnstoff |
| N'-(3-Chlorophenyl)-N,N-dipropylurea |