4-chloro-6-(4-methylpiperazin-1-yl)-5-nitropyrimidine structure
|
Common Name | 4-chloro-6-(4-methylpiperazin-1-yl)-5-nitropyrimidine | ||
|---|---|---|---|---|
| CAS Number | 154418-73-2 | Molecular Weight | 257.67700 | |
| Density | 1.408g/cm3 | Boiling Point | 424.403ºC at 760 mmHg | |
| Molecular Formula | C9H12ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.472ºC | |
| Name | 4-chloro-6-(4-methylpiperazin-1-yl)-5-nitropyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.408g/cm3 |
|---|---|
| Boiling Point | 424.403ºC at 760 mmHg |
| Molecular Formula | C9H12ClN5O2 |
| Molecular Weight | 257.67700 |
| Flash Point | 210.472ºC |
| Exact Mass | 257.06800 |
| PSA | 78.08000 |
| LogP | 1.31610 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | QVRVBORXKOSPAY-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2ncnc(Cl)c2[N+](=O)[O-])CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-chloro-6-(4-methyl-1-piperazinyl)-5-nitropyrimidine |
| qc-6726 |