H-Arg-Arg-Arg-Ala-Asp-Asp-Ser-Asp-Asp-Asp-Asp-Asp-OH structure
|
Common Name | H-Arg-Arg-Arg-Ala-Asp-Asp-Ser-Asp-Asp-Asp-Asp-Asp-OH | ||
|---|---|---|---|---|
| CAS Number | 154444-98-1 | Molecular Weight | 1450.34000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C52H83N21O28 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | H-Arg-Arg-Arg-Ala-Asp-Asp-Ser-Asp-Asp-Asp-Asp-Asp-OH |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C52H83N21O28 |
|---|---|
| Molecular Weight | 1450.34000 |
| Exact Mass | 1449.57000 |
| PSA | 850.45000 |
| InChIKey | NSTKIPFKPLZQKH-UPPQRMANSA-N |
| SMILES | CC(NC(=O)C(CCCNC(=N)N)NC(=O)C(CCCNC(=N)N)NC(=O)C(N)CCCNC(=N)N)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(CO)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Design and synthesis of two new peptide substrates for the specific and sensitive monitoring of casein kinases-1 and -2.
Biochem. Biophys. Res. Commun. 198 , 898, (1994) The available information about the specificity determinants of casein kinases-1 and -2 (CK1 and CK2) has been utilized to obtain two new peptide substrates optimally suited for the specific monitorin... |
| h-arg-arg-arg-ala-asp-asp-ser-(asp)-5-oh |
| arg-arg-arg-ala-asp-asp-ser-[asp]5 |
| ein kinase-2 substrate |