1,2-Benzisothiazole,2,3-dihydro-5-methyl-2,3,3-triphenyl-, 1,1-dioxide structure
|
Common Name | 1,2-Benzisothiazole,2,3-dihydro-5-methyl-2,3,3-triphenyl-, 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 15449-02-2 | Molecular Weight | 411.51500 | |
| Density | 1.272g/cm3 | Boiling Point | 551.4ºC at 760mmHg | |
| Molecular Formula | C26H21NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.3ºC | |
| Name | 5-methyl-2,3,3-triphenyl-1,2-benzothiazole 1,1-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 551.4ºC at 760mmHg |
| Molecular Formula | C26H21NO2S |
| Molecular Weight | 411.51500 |
| Flash Point | 287.3ºC |
| Exact Mass | 411.12900 |
| PSA | 45.76000 |
| LogP | 6.64160 |
| Vapour Pressure | 3.32E-12mmHg at 25°C |
| Index of Refraction | 1.669 |
| InChIKey | TWAODYDCWOXTDX-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)C(c1ccccc1)(c1ccccc1)N(c1ccccc1)S2(=O)=O |
|
~%
1,2-Benzisothia... CAS#:15449-02-2 |
| Literature: Watanabe,H. et al. Journal of Organic Chemistry, 1968 , vol. 33, # 2 p. 900 - 903 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-methyl-2,3,3-triphenyl-2,3-dihydro-1,2-benzothiazole 1,1-dioxide |
| 5-Methyl-2,3,3-triphenyl-2,3-dihydro-1,2-benzthiazol-1,1-dioxid |