2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine
Modify Date: 2026-08-31 12:37:06
![2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine Structure](https://www.chemsrc.com/extcaspic/101/1545490-84-3.png)
2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine structure
|
Common Name | 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine | ||
|---|---|---|---|---|
| CAS Number | 1545490-84-3 | Molecular Weight | 305.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10BrFN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H10BrFN2 |
|---|---|
| Molecular Weight | 305.14 |
| InChIKey | UBRYXYPIDFXLTN-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(-c3ccc(F)c(Br)c3)cn2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine? |
| A: InChIKey of 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine is UBRYXYPIDFXLTN-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine? |
| A: CAS number of 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine is 1545490-84-3. |
| Q: What is the molecular weight of 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine? |
| A: Molecular weight of 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine is 305.14. |
| Q: What is the SMILES notation of 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine? |
| A: SMILES notation of 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine is Cc1ccc2nc(-c3ccc(F)c(Br)c3)cn2c1. |
| Q: What is the English name of 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine? |
| A: The English name of 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine is 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine. |
| Q: What is the Chinese name of 1545490-84-3? |
| A: Chinese name of 1545490-84-3 is 1545490-84-3. |
| Q: What is the molecular formula of 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine? |
| A: Molecular formula of 2-(3-Bromo-4-fluorophenyl)-6-methylimidazo[1,2-A]pyridine is C14H10BrFN2. |