Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl
Modify Date: 2026-09-27 09:56:01
![Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl Structure](https://www.chemsrc.com/extcaspic/053/1545534-45-9.png)
Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl structure
|
Common Name | Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl | ||
|---|---|---|---|---|
| CAS Number | 1545534-45-9 | Molecular Weight | 229.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19N3 |
|---|---|
| Molecular Weight | 229.32 |
| InChIKey | IYIXSVPEQJVRQP-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n2c3c(nc2n1)C(C)CCC3C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl? |
| A: Molecular formula of Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl is C14H19N3. |
| Q: What is the molecular weight of Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl? |
| A: Molecular weight of Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl is 229.32. |
| Q: What is the InChIKey of Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl? |
| A: InChIKey of Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl is IYIXSVPEQJVRQP-UHFFFAOYSA-N. |
| Q: What is the English name of Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl? |
| A: The English name of Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl is Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl. |
| Q: What is the SMILES notation of Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl? |
| A: SMILES notation of Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl is Cc1cc(C)n2c3c(nc2n1)C(C)CCC3C. |
| Q: What is the Chinese name of 1545534-45-9? |
| A: Chinese name of 1545534-45-9 is 1545534-45-9. |
| Q: What is the CAS number of Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl? |
| A: CAS number of Pyrimido[1,2-a]benzimidazole, 6,7,8,9-tetrahydro-2,4,6,9-tetramethyl is 1545534-45-9. |