8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine
Modify Date: 2025-09-09 19:10:38
![8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine Structure](https://www.chemsrc.com/extcaspic/289/1545557-69-4.png)
8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine structure
|
Common Name | 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine | ||
|---|---|---|---|---|
| CAS Number | 1545557-69-4 | Molecular Weight | 309.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7BrF2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H7BrF2N2 |
|---|---|
| Molecular Weight | 309.11 |
| InChIKey | CUYODECXZYFPKL-UHFFFAOYSA-N |
| SMILES | Fc1ccc(-c2cn3cccc(Br)c3n2)c(F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1545557-69-4? |
| A: Chinese name of 1545557-69-4 is 1545557-69-4. |
| Q: What is the InChIKey of 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine? |
| A: InChIKey of 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine is CUYODECXZYFPKL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine? |
| A: Molecular weight of 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine is 309.11. |
| Q: What is the CAS number of 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine? |
| A: CAS number of 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine is 1545557-69-4. |
| Q: What is the molecular formula of 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine? |
| A: Molecular formula of 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine is C13H7BrF2N2. |
| Q: What is the English name of 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine? |
| A: The English name of 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine is 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine. |
| Q: What is the SMILES notation of 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine? |
| A: SMILES notation of 8-Bromo-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine is Fc1ccc(-c2cn3cccc(Br)c3n2)c(F)c1. |