4-(Benzoylamino)phenol structure
|
Common Name | 4-(Benzoylamino)phenol | ||
|---|---|---|---|---|
| CAS Number | 15457-50-8 | Molecular Weight | 213.23200 | |
| Density | 1.278g/cm3 | Boiling Point | 302.1ºC at 760mmHg | |
| Molecular Formula | C13H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.5ºC | |
| Name | N-(4-Hydroxyphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 302.1ºC at 760mmHg |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.23200 |
| Flash Point | 136.5ºC |
| Exact Mass | 213.07900 |
| PSA | 49.33000 |
| LogP | 2.71750 |
| Vapour Pressure | 0.000565mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | CVPWYDXAVJCNAG-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(O)cc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(p-hydroxyphenyl)benzamide |
| p-Benzamidophenol |
| p-benzoylaminophenol |
| N-(4-hydroxyphenyl)-benzamide |
| 4'-Hydroxybenzanilide |
| 4-(benzoylamino)phenol |