6,7-Dimethoxy-1-(4-methoxyphenyl)-3,4-dihydroisoquinoline structure
|
Common Name | 6,7-Dimethoxy-1-(4-methoxyphenyl)-3,4-dihydroisoquinoline | ||
|---|---|---|---|---|
| CAS Number | 15462-83-6 | Molecular Weight | 297.34800 | |
| Density | 1.15g/cm3 | Boiling Point | 429.3ºC at 760 mmHg | |
| Molecular Formula | C18H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.9ºC | |
| Name | 6,7-Dimethoxy-1-(4-methoxyphenyl)-3,4-dihydroisoquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 429.3ºC at 760 mmHg |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.34800 |
| Flash Point | 171.9ºC |
| Exact Mass | 297.13600 |
| PSA | 40.05000 |
| LogP | 2.54150 |
| Vapour Pressure | 3.56E-07mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | UQYSBDOHIQHGKF-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2=NCCc3cc(OC)c(OC)cc32)cc1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-Methoxy-phenyl)-6,7-dimethoxy-3,4-dihydro-isochinolin |
| 6,7-Dimethoxy-1-(p-methoxyphenyl)-3,4-dihydroisoquinoline |
| HMS2513P24 |
| 6,7-dimethoxy-1-(4-methoxy-phenyl)-3,4-dihydro-isoquinoline |
| 6,7-dimethoxy-1-<(para-methoxy)phenyl>-3,4-dihydroisoquinoline |
| 6,7-Dimethoxy-1-(4-methoxy-phenyl)-3,4-dihydro-isochinolin |