Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl
Modify Date: 2026-07-09 18:10:51
Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl structure
|
Common Name | Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl | ||
|---|---|---|---|---|
| CAS Number | 1546711-95-8 | Molecular Weight | 195.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H17N3O |
|---|---|
| Molecular Weight | 195.26 |
| InChIKey | XENFLFNAGCXKFH-UHFFFAOYSA-N |
| SMILES | CCN(CCC#N)C(=O)C1(CN)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl? |
| A: Molecular formula of Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl is C10H17N3O. |
| Q: What is the molecular weight of Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl? |
| A: Molecular weight of Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl is 195.26. |
| Q: What is the English name of Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl? |
| A: The English name of Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl is Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl. |
| Q: What is the Chinese name of 1546711-95-8? |
| A: Chinese name of 1546711-95-8 is 1546711-95-8. |
| Q: What is the CAS number of Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl? |
| A: CAS number of Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl is 1546711-95-8. |
| Q: What is the InChIKey of Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl? |
| A: InChIKey of Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl is XENFLFNAGCXKFH-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl? |
| A: SMILES notation of Cyclopropanecarboxamide, 1-(aminomethyl)-N-(2-cyanoethyl)-N-ethyl is CCN(CCC#N)C(=O)C1(CN)CC1. |