(9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate
Modify Date: 2026-07-11 07:02:13
![(9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate Structure](https://www.chemsrc.com/extcaspic/495/1546764-23-1.png)
(9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate structure
|
Common Name | (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate | ||
|---|---|---|---|---|
| CAS Number | 1546764-23-1 | Molecular Weight | 323.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H21NO3 |
|---|---|
| Molecular Weight | 323.4 |
| InChIKey | AGXOIYALFSKDBH-UHFFFAOYSA-N |
| SMILES | O=C(NCC1(CO)CC1)OCC1c2ccccc2-c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate? |
| A: Molecular weight of (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate is 323.4. |
| Q: What is the InChIKey of (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate? |
| A: InChIKey of (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate is AGXOIYALFSKDBH-UHFFFAOYSA-N. |
| Q: What is the English name of (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate? |
| A: The English name of (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate is (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate. |
| Q: What is the molecular formula of (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate? |
| A: Molecular formula of (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate is C20H21NO3. |
| Q: What is the CAS number of (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate? |
| A: CAS number of (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate is 1546764-23-1. |
| Q: What is the SMILES notation of (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate? |
| A: SMILES notation of (9H-fluoren-9-yl)methyl N-{[1-(hydroxymethyl)cyclopropyl]methyl}carbamate is O=C(NCC1(CO)CC1)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the Chinese name of 1546764-23-1? |
| A: Chinese name of 1546764-23-1 is 1546764-23-1. |