arginyl adenylate
Modify Date: 2024-02-04 17:29:19
arginyl adenylate structure
|
Common Name | arginyl adenylate | ||
|---|---|---|---|---|
| CAS Number | 15470-08-3 | Molecular Weight | 503.40700 | |
| Density | 2.03g/cm3 | Boiling Point | 877.4ºC at 760mmHg | |
| Molecular Formula | C16H26N9O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 484.4ºC | |
| Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.03g/cm3 |
|---|---|
| Boiling Point | 877.4ºC at 760mmHg |
| Molecular Formula | C16H26N9O8P |
| Molecular Weight | 503.40700 |
| Flash Point | 484.4ºC |
| Exact Mass | 503.16400 |
| PSA | 289.87000 |
| Vapour Pressure | 6.12E-33mmHg at 25°C |
| Index of Refraction | 1.82 |
| InChIKey | AJYPLWAQPDERQG-TWBCTODHSA-N |
| SMILES | NC(N)=NCCCC(N)C(=O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1O |
| Arginyl adenylate |
| L-Arginine,monoanhydride with 5'-adenylic acid |