bis(benzoylthio)dibutylstannane structure
|
Common Name | bis(benzoylthio)dibutylstannane | ||
|---|---|---|---|---|
| CAS Number | 15481-48-8 | Molecular Weight | 507.28800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28O2S2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-[benzoylsulfanyl(dibutyl)stannyl] benzenecarbothioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H28O2S2Sn |
|---|---|
| Molecular Weight | 507.28800 |
| Exact Mass | 508.05500 |
| PSA | 34.14000 |
| LogP | 5.60780 |
| InChIKey | BRIMXLZSNXEUEL-UHFFFAOYSA-L |
| SMILES | CCCC[Sn](CCCC)(SC(=O)c1ccccc1)SC(=O)c1ccccc1 |
| HS Code | 2930909090 |
|---|
|
~76%
bis(benzoylthio... CAS#:15481-48-8 |
| Literature: Coldea, Victoria; Haiduc, Ionel Synthesis and Reactivity in Inorganic and Metal-Organic Chemistry, 1980 , vol. 10, p. 417 - 424 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Stannane,bis(benzoylthio)dibutyl-(8CI,9CI) |
| dibutyltin bis(monothiobenzoate) |
| Bis(benzoylthio)dibutylstannane |
| EINECS 239-503-7 |
| Tin,bis(benzoylthio)dibutyl-(7CI) |
| Dibutyltinbis(thiobenzoate) (6CI) |
| Benzoic acid,thio-,S,S'-(dibutylstannylene) deriv. (8CI) |