2-(p-Chlorophenoxy)propionic acid 2-(dimethylamino)ethyl ester structure
|
Common Name | 2-(p-Chlorophenoxy)propionic acid 2-(dimethylamino)ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 15485-48-0 | Molecular Weight | 271.74000 | |
| Density | 1.153g/cm3 | Boiling Point | 355ºC at 760mmHg | |
| Molecular Formula | C13H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.5ºC | |
| Name | 2-(dimethylamino)ethyl 2-(4-chlorophenoxy)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.153g/cm3 |
|---|---|
| Boiling Point | 355ºC at 760mmHg |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74000 |
| Flash Point | 168.5ºC |
| Exact Mass | 271.09800 |
| PSA | 38.77000 |
| LogP | 2.21210 |
| Vapour Pressure | 3.22E-05mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | WXPANMBBQDIBJJ-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccc(Cl)cc1)C(=O)OCCN(C)C |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(p-Chlorophenoxy)propionic acid dimethylaminoethyl ester |
| NP 293 |
| 2-dimethylaminoethyl 2-(4-chlorophenoxy)propanoate |
| Propionic acid,2-(p-chlorophenoxy)-,2-(dimethylamino)ethyl ester |
| 2-(4-Chlorphenoxy)-propionsaeure-(2-dimethylaminoethylester) |