6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine
Modify Date: 2025-08-27 11:05:34
![6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine Structure](https://www.chemsrc.com/extcaspic/418/1549066-85-4.png)
6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine structure
|
Common Name | 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine | ||
|---|---|---|---|---|
| CAS Number | 1549066-85-4 | Molecular Weight | 281.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7Cl2FN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H7Cl2FN2 |
|---|---|
| Molecular Weight | 281.11 |
| InChIKey | OOTAOCKLLJLPAJ-UHFFFAOYSA-N |
| SMILES | Fc1cccc(-c2cn3cc(Cl)cc(Cl)c3n2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine? |
| A: The English name of 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine is 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine. |
| Q: What is the Chinese name of 1549066-85-4? |
| A: Chinese name of 1549066-85-4 is 1549066-85-4. |
| Q: What is the CAS number of 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine? |
| A: CAS number of 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine is 1549066-85-4. |
| Q: What is the molecular weight of 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine? |
| A: Molecular weight of 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine is 281.11. |
| Q: What is the InChIKey of 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine? |
| A: InChIKey of 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine is OOTAOCKLLJLPAJ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine? |
| A: Molecular formula of 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine is C13H7Cl2FN2. |
| Q: What is the SMILES notation of 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine? |
| A: SMILES notation of 6,8-Dichloro-2-(3-fluorophenyl)imidazo[1,2-a]pyridine is Fc1cccc(-c2cn3cc(Cl)cc(Cl)c3n2)c1. |