Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl]
Modify Date: 2026-07-06 21:58:45
![Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl] Structure](https://www.chemsrc.com/extcaspic/285/1549675-26-4.png)
Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl] structure
|
Common Name | Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl] | ||
|---|---|---|---|---|
| CAS Number | 1549675-26-4 | Molecular Weight | 325.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14F3NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14F3NO4S |
|---|---|
| Molecular Weight | 325.31 |
| InChIKey | YVSKXOYFCZDVKH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCCCCC(F)(F)F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl]? |
| A: SMILES notation of Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl] is O=C(O)c1ccc(S(=O)(=O)NCCCCC(F)(F)F)cc1. |
| Q: What is the English name of Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl]? |
| A: The English name of Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl] is Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl]. |
| Q: What is the InChIKey of Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl]? |
| A: InChIKey of Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl] is YVSKXOYFCZDVKH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl]? |
| A: Molecular formula of Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl] is C12H14F3NO4S. |
| Q: What is the CAS number of Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl]? |
| A: CAS number of Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl] is 1549675-26-4. |
| Q: What is the molecular weight of Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl]? |
| A: Molecular weight of Benzoic acid, 4-[[(5,5,5-trifluoropentyl)amino]sulfonyl] is 325.31. |
| Q: What is the Chinese name of 1549675-26-4? |
| A: Chinese name of 1549675-26-4 is 1549675-26-4. |