N-(7-Oxo-1,3,5-cycloheptatrien-1-yl)-β-alanine 2-(dimethylamino)ethyl ester structure
|
Common Name | N-(7-Oxo-1,3,5-cycloheptatrien-1-yl)-β-alanine 2-(dimethylamino)ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 15499-09-9 | Molecular Weight | 264.32000 | |
| Density | 1.12g/cm3 | Boiling Point | 445ºC at 760mmHg | |
| Molecular Formula | C14H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.9ºC | |
| Name | 2-(dimethylamino)ethyl 3-[(7-oxocyclohepta-1,3,5-trien-1-yl)amino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 445ºC at 760mmHg |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32000 |
| Flash Point | 222.9ºC |
| Exact Mass | 264.14700 |
| PSA | 58.64000 |
| LogP | 1.02660 |
| Vapour Pressure | 4.1E-08mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | ZCALLRJEILXULN-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC(=O)CCNc1cccccc1=O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-<2-(2-Dimethylamino-aethoxycarbonyl)-aethylamino>-1-oxo-cycloheptatrien-(2,4,6) |
| 2-dimethylaminoethyl 3-[(7-oxocyclohepta-1,3,5-trien-1-yl)amino]propanoate |