9-hydroxy-10,12-Octadecadienoic acid structure
|
Common Name | 9-hydroxy-10,12-Octadecadienoic acid | ||
|---|---|---|---|---|
| CAS Number | 15514-85-9 | Molecular Weight | 296.44500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-hydroxy-10,12-Octadecadienoic acid |
|---|
| Molecular Formula | C18H32O3 |
|---|---|
| Molecular Weight | 296.44500 |
| Exact Mass | 296.23500 |
| PSA | 57.53000 |
| LogP | 4.85530 |
| Vapour Pressure | 1.15E-08mmHg at 25°C |
| InChIKey | NPDSHTNEKLQQIJ-SIGMCMEVSA-N |
| SMILES | CCCCCC=CC=CC(O)CCCCCCCC(=O)O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |