17-Phenyl trinor prostaglandin F2α methyl amide structure
|
Common Name | 17-Phenyl trinor prostaglandin F2α methyl amide | ||
|---|---|---|---|---|
| CAS Number | 155206-01-2 | Molecular Weight | 401.54 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 621.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H35NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.7±31.5 °C | |
Use of 17-Phenyl trinor prostaglandin F2α methyl amide17-Phenyl trinor prostaglandin F2α methyl amide is a prostaglandin F 2α (PGF 2α) analog that competes with native PGF 2α for receptor binding[1]. |
| Name | 17-phenyl trinor Prostaglandin F2.α. methyl amide |
|---|---|
| Synonym | More Synonyms |
| Description | 17-Phenyl trinor prostaglandin F2α methyl amide is a prostaglandin F 2α (PGF 2α) analog that competes with native PGF 2α for receptor binding[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 621.5±55.0 °C at 760 mmHg |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.54 |
| Flash Point | 329.7±31.5 °C |
| Exact Mass | 401.256622 |
| PSA | 89.79000 |
| LogP | 1.45 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | UWIWNJFBNIMMGY-FDBOBMRISA-N |
| SMILES | CNC(=O)CCCC=CCC1C(O)CC(O)C1C=CC(O)CCc1ccccc1 |
| (5Z)-7-{(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(1E,3S)-3-hydroxy-5-phenyl-1-penten-1-yl]cyclopentyl}-N-methyl-5-heptenamide |
| 5-Heptenamide, 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxy-5-phenyl-1-penten-1-yl]cyclopentyl]-N-methyl-, (5Z)- |