Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl]
Modify Date: 2026-07-05 10:16:21
![Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl] Structure](https://www.chemsrc.com/extcaspic/029/1552457-96-1.png)
Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl] structure
|
Common Name | Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl] | ||
|---|---|---|---|---|
| CAS Number | 1552457-96-1 | Molecular Weight | 282.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H5F3N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H5F3N4O2 |
|---|---|
| Molecular Weight | 282.18 |
| InChIKey | DTUHSSRMMMLJCP-UHFFFAOYSA-N |
| SMILES | N#Cc1cc(-n2ccc(C(F)(F)F)n2)ccc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl]? |
| A: CAS number of Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl] is 1552457-96-1. |
| Q: What is the molecular weight of Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl]? |
| A: Molecular weight of Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl] is 282.18. |
| Q: What is the English name of Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl]? |
| A: The English name of Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl] is Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl]. |
| Q: What is the Chinese name of 1552457-96-1? |
| A: Chinese name of 1552457-96-1 is 1552457-96-1. |
| Q: What is the molecular formula of Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl]? |
| A: Molecular formula of Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl] is C11H5F3N4O2. |
| Q: What is the InChIKey of Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl]? |
| A: InChIKey of Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl] is DTUHSSRMMMLJCP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl]? |
| A: SMILES notation of Benzonitrile, 2-nitro-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl] is N#Cc1cc(-n2ccc(C(F)(F)F)n2)ccc1[N+](=O)[O-]. |