2-[Methyl(2-phenylacetyl)amino]acetic acid structure
|
Common Name | 2-[Methyl(2-phenylacetyl)amino]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 155256-51-2 | Molecular Weight | 207.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[Methyl(2-phenylacetyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13NO3 |
|---|---|
| Molecular Weight | 207.22600 |
| Exact Mass | 207.09000 |
| PSA | 57.61000 |
| LogP | 0.77210 |
| InChIKey | BJGKAXRKVQCKOA-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C(=O)Cc1ccccc1 |
| HS Code | 2922499990 |
|---|
|
~%
2-[Methyl(2-phe... CAS#:155256-51-2 |
| Literature: Coppola, Brian P.; Noe, Mark C.; Schwartz, David J.; Abdon II, Robert L.; Trost, Barry M. Tetrahedron, 1994 , vol. 50, # 1 p. 93 - 116 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| N-phenylacetyl-glycine nitrile |
| N-phenylacetyl-N-methylglycine |
| N-Phenylacetyl-glycin-nitril |
| N-Phenylacetyl-aminoacetonitrile |
| N-methyl-N-(phenylacetyl)glycine |