4-[4'-(3-Butenyl)[1,1'-bicyclohexyl]-4-yl]-1,2-difluorobenzene
![4-[4'-(3-Butenyl)[1,1'-bicyclohexyl]-4-yl]-1,2-difluorobenzene Structure](https://image.chemsrc.com/caspic/054/155266-68-5.png)
4-[4'-(3-Butenyl)[1,1'-bicyclohexyl]-4-yl]-1,2-difluorobenzene structure
|
Common Name | 4-[4'-(3-Butenyl)[1,1'-bicyclohexyl]-4-yl]-1,2-difluorobenzene | ||
|---|---|---|---|---|
| CAS Number | 155266-68-5 | Molecular Weight | 332.47000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H30F2 | Melting Point | 43 °C | |
| MSDS | N/A | Flash Point | 164.528ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 43 °C |
|---|---|
| Molecular Formula | C22H30F2 |
| Molecular Weight | 332.47000 |
| Flash Point | 164.528ºC |
| Exact Mass | 332.23200 |
| LogP | 7.01120 |
| InChIKey | UMULWEQZNFZORL-UHFFFAOYSA-N |
| SMILES | C=CCCC1CCC(C2CCC(c3ccc(F)c(F)c3)CC2)CC1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2903999090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene? |
| A: InChIKey of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene is UMULWEQZNFZORL-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene? |
| A: CAS number of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene is 155266-68-5. |
| Q: What is the molecular formula of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene? |
| A: Molecular formula of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene is C22H30F2. |
| Q: What is the English name of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene? |
| A: The English name of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene is 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene. |
| Q: What is the LogP of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene? |
| A: LogP of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene is 7.01120. |
| Q: What is the melting point of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene? |
| A: Melting point of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene is 43 °C. |
| Q: What is the molecular weight of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene? |
| A: Molecular weight of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene is 332.47000. |
| Q: What is the SMILES notation of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene? |
| A: SMILES notation of 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,2-difluorobenzene is C=CCCC1CCC(C2CCC(c3ccc(F)c(F)c3)CC2)CC1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |