1-(3,4-dihydroxyphenyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]ethan-1-one structure
|
Common Name | 1-(3,4-dihydroxyphenyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]ethan-1-one | ||
|---|---|---|---|---|
| CAS Number | 15532-98-6 | Molecular Weight | 342.38900 | |
| Density | 1.265g/cm3 | Boiling Point | 583.6ºC at 760mmHg | |
| Molecular Formula | C19H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.8ºC | |
| Name | 1-(3,4-dihydroxyphenyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 583.6ºC at 760mmHg |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.38900 |
| Flash Point | 306.8ºC |
| Exact Mass | 342.15800 |
| PSA | 73.24000 |
| LogP | 2.11420 |
| Vapour Pressure | 3.22E-14mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | MPHPDMUOEKCXGX-UHFFFAOYSA-N |
| SMILES | COc1ccccc1N1CCN(CC(=O)c2ccc(O)c(O)c2)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(3,4-dihydroxy-phenyl)-2-[4-(2-methoxy-phenyl)-piperazin-1-yl]-ethanone |
| 1-(3,4-DIHYDROXYPHENYL)-2-[4-(2-METHOXYPHENYL)PIPERAZIN-1-YL]ETHAN-1-ONE |
| EINECS 239-576-5 |