methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate
![methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate Structure](https://image.chemsrc.com/caspic/234/155337-52-3.png)
methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate structure
|
Common Name | methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 155337-52-3 | Molecular Weight | 287.39700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H25NO2 |
|---|---|
| Molecular Weight | 287.39700 |
| Exact Mass | 287.18900 |
| PSA | 29.54000 |
| LogP | 2.92620 |
| InChIKey | UAMCGXVVAUEEEU-HZMVEIRTSA-N |
| SMILES | CCc1ccc(C2CC3CCC(C2C(=O)OC)N3C)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~78%
methyl 3-(4-eth... CAS#:155337-52-3 |
| Literature: Blough, Bruce E.; Abraham, Philip; Lewin, Anita H.; Kuhar, Michael J.; Boja, John W.; Ivy Carroll Journal of Medicinal Chemistry, 1996 , vol. 39, # 20 p. 4027 - 4035 |
|
~%
methyl 3-(4-eth... CAS#:155337-52-3 |
| Literature: Blough, Bruce E.; Abraham, Philip; Lewin, Anita H.; Kuhar, Michael J.; Boja, John W.; Ivy Carroll Journal of Medicinal Chemistry, 1996 , vol. 39, # 20 p. 4027 - 4035 |
![(1R,2S,3S,5S)-Methyl 3-(4-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate structure](https://image.chemsrc.com/caspic/235/135416-43-2.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| rti-83 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate? |
| A: Molecular weight of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate is 287.39700. |
| Q: What is the CAS number of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate? |
| A: CAS number of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate is 155337-52-3. |
| Q: What English synonyms does methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate have? |
| A: English synonyms of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate: rti-83. |
| Q: What is the molecular formula of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate? |
| A: Molecular formula of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate is C18H25NO2. |
| Q: What is the InChIKey of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate? |
| A: InChIKey of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate is UAMCGXVVAUEEEU-HZMVEIRTSA-N. |
| Q: What is the SMILES notation of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate? |
| A: SMILES notation of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate is CCc1ccc(C2CC3CCC(C2C(=O)OC)N3C)cc1. |
| Q: What is the LogP of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate? |
| A: LogP of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate is 2.92620. |
| Q: What is the English name of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate? |
| A: The English name of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate is methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate. |
| Q: What is the polar surface area (PSA) of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate? |
| A: Polar surface area (PSA) of methyl 3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate is 29.54000. |
| Q: What is the Chinese name of 155337-52-3? |
| A: Chinese name of 155337-52-3 is 155337-52-3. |