Ethylphosphonic acid p-nitrophenyl(methyl) ester structure
|
Common Name | Ethylphosphonic acid p-nitrophenyl(methyl) ester | ||
|---|---|---|---|---|
| CAS Number | 15536-01-3 | Molecular Weight | 245.16900 | |
| Density | 1.298g/cm3 | Boiling Point | 356ºC at 760mmHg | |
| Molecular Formula | C9H12NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.1ºC | |
| Name | 1-[ethyl(methoxy)phosphoryl]oxy-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 356ºC at 760mmHg |
| Molecular Formula | C9H12NO5P |
| Molecular Weight | 245.16900 |
| Flash Point | 169.1ºC |
| Exact Mass | 245.04500 |
| PSA | 91.16000 |
| LogP | 3.35620 |
| Vapour Pressure | 6.17E-05mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | ANOLNVUBNLISAF-UHFFFAOYSA-N |
| SMILES | CCP(=O)(OC)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2931900090 |
|---|
|
~%
Ethylphosphonic... CAS#:15536-01-3 |
| Literature: Rasumow et al. Zhurnal Obshchei Khimii, 1957 , vol. 27, p. 2394; engl. Ausg. S. 2455 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Methyl p-nitrophenyl ethylphosphonate |
| ethyl-phosphonic acid methyl ester-(4-nitro-phenyl ester) |
| Phosphonic acid,ethyl-,methyl p-nitrophenyl ester |
| Aethyl-phosphonsaeure-methylester-(4-nitro-phenylester) |
| methyl 4-nitrophenyl ethylphosphonate |