8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene
![8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene Structure](https://image.chemsrc.com/caspic/374/155366-02-2.png)
8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene structure
|
Common Name | 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene | ||
|---|---|---|---|---|
| CAS Number | 155366-02-2 | Molecular Weight | 252.25700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14F2O2 |
|---|---|
| Molecular Weight | 252.25700 |
| Exact Mass | 252.09600 |
| PSA | 18.46000 |
| LogP | 3.27520 |
| InChIKey | HYFKSBBPWWJJKI-UHFFFAOYSA-N |
| SMILES | Fc1cc(F)cc(C2=CCC3(CC2)OCCO3)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
8-(3,5-difluoro... CAS#:155366-02-2 |
| Literature: JNC Corporation; JNC Petrochemical Corporation; MASUKAWA, Tokifumi Patent: EP2690103 A1, 2014 ; |
|
~%
8-(3,5-difluoro... CAS#:155366-02-2 |
| Literature: JNC Corporation; JNC Petrochemical Corporation; MASUKAWA, Tokifumi Patent: EP2690103 A1, 2014 ; |
|
~85%
8-(3,5-difluoro... CAS#:155366-02-2 |
| Literature: Ding, Fa-Xiang; Shen, Hong C.; Wilsie, Larrisa C.; Krsmanovic, Mihajlo L.; Taggart, Andrew K.; Ren, Ning; Cai, Tian-Quan; Wang, Junying; Tong, Xinchun; Holt, Tom G.; Chen, Qing; Gerard Waters; Hammond, Milton L.; Tata, James R.; Colletti, Steven L. Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 11 p. 3372 - 3375 |
![1,4-Dioxaspiro[4.5]decan-8-one structure](https://image.chemsrc.com/caspic/201/4746-97-8.png)
![1,4-Dioxaspiro[4.5]dec-7-en-8-yl trifluoromethanesulfonate structure](https://image.chemsrc.com/caspic/490/170011-47-9.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-Dioxaspiro[4.5]dec-7-ene,8-(3,5-difluorophenyl) |
| 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4,5]dec-7-ene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene? |
| A: Polar surface area (PSA) of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene is 18.46000. |
| Q: What is the CAS number of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene? |
| A: CAS number of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene is 155366-02-2. |
| Q: What is the molecular weight of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene? |
| A: Molecular weight of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene is 252.25700. |
| Q: What is the InChIKey of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene? |
| A: InChIKey of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene is HYFKSBBPWWJJKI-UHFFFAOYSA-N. |
| Q: What English synonyms does 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene have? |
| A: English synonyms of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene: 1,4-Dioxaspiro[4.5]dec-7-ene,8-(3,5-difluorophenyl), 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4,5]dec-7-ene. |
| Q: What is the molecular formula of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene? |
| A: Molecular formula of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene is C14H14F2O2. |
| Q: What is the LogP of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene? |
| A: LogP of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene is 3.27520. |
| Q: What is the SMILES notation of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene? |
| A: SMILES notation of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene is Fc1cc(F)cc(C2=CCC3(CC2)OCCO3)c1. |
| Q: What is the English name of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene? |
| A: The English name of 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene is 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene. |
| Q: What is the Chinese name of 155366-02-2? |
| A: Chinese name of 155366-02-2 is 155366-02-2. |