3,6-Dimethyl-2-nitroaniline structure
|
Common Name | 3,6-Dimethyl-2-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 15540-85-9 | Molecular Weight | 166.177 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 305.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.2±26.5 °C | |
| Name | 3,6-dimethyl-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 305.0±37.0 °C at 760 mmHg |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.177 |
| Flash Point | 138.2±26.5 °C |
| Exact Mass | 166.074234 |
| PSA | 71.84000 |
| LogP | 2.75 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | DOEMKIFSRKILHU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c([N+](=O)[O-])c1N |
| HS Code | 2921430090 |
|---|
|
~%
3,6-Dimethyl-2-... CAS#:15540-85-9 |
| Literature: van Helden et al. Recueil des Travaux Chimiques des Pays-Bas, 1954 , vol. 73, p. 39,47 |
|
~%
3,6-Dimethyl-2-... CAS#:15540-85-9 |
| Literature: Noelting; Witt; Forel Chemische Berichte, 1885 , vol. 18, p. 2667 |
|
~%
3,6-Dimethyl-2-... CAS#:15540-85-9 |
| Literature: Noelting; Witt; Forel Chemische Berichte, 1885 , vol. 18, p. 2667 |
|
~%
3,6-Dimethyl-2-... CAS#:15540-85-9 |
| Literature: Thulin, Bengt; Wennerstroem, Olof Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1983 , vol. 37, # 7 p. 589 - 596 |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,5-dimethyl-6-nitroaniline |
| 3,6-Dimethyl-2-nitroaniline |
| 3,6-Dimethyl-2-nitro-anilin |
| 2,5-Dimethyl-6-nitroanilin |
| 3,6-dimethyl-2-nitro-aniline |
| Benzenamine,3,6-dimethyl-2-nitro |
| p-Nitro-p-xylidin |
| 3,6-dimethyl-2-nitrophenylamine |
| 6-Nitro-2,5-acetoxylidid |
| 2-amino-3-nitro-p-xylene |