Carbolactone structure
|
Common Name | Carbolactone | ||
|---|---|---|---|---|
| CAS Number | 155443-55-3 | Molecular Weight | 372.541 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 508.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H36O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.7±22.9 °C | |
Use of CarbolactoneCarbolactone is a biologically active metabolite from fungi[1]. |
| Name | Carbolactone |
|---|---|
| Synonym | More Synonyms |
| Description | Carbolactone is a biologically active metabolite from fungi[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 508.7±50.0 °C at 760 mmHg |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.541 |
| Flash Point | 199.7±22.9 °C |
| Exact Mass | 372.266449 |
| LogP | 5.09 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | ICBKTZVCTSCWTL-WYCYEJLCSA-N |
| SMILES | CC1C(=O)OC2CC3=C(CCC4C3(C)CCC(O)C4(C)C)C3CCC1C23C |
| Carbolactone |
| Pregn-8-en-21-one, 12,21-epoxy-3-hydroxy-4,4,20-trimethyl-, (3β,5α,12β,20S)- |
| (3β,5α,12β,20S)-3-Hydroxy-4,4,20-trimethyl-12,21-epoxypregn-8-en-21-one |