benzyl alpha-d-mannopyranoside structure
|
Common Name | benzyl alpha-d-mannopyranoside | ||
|---|---|---|---|---|
| CAS Number | 15548-45-5 | Molecular Weight | 270.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O6 | Melting Point | 126-129°C | |
| MSDS | USA | Flash Point | N/A | |
| Name | 2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 126-129°C |
|---|---|
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.27800 |
| Exact Mass | 270.11000 |
| PSA | 99.38000 |
| Index of Refraction | 1.612 |
| InChIKey | GKHCBYYBLTXYEV-UHFFFAOYSA-N |
| SMILES | OCC1OC(OCc2ccccc2)C(O)C(O)C1O |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932999099 |
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00153924 |
| AmbotzGBB1221 |