ethyl 1-nitro-4-oxoquinolizine-3-carboxylate structure
|
Common Name | ethyl 1-nitro-4-oxoquinolizine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1556-30-5 | Molecular Weight | 262.21800 | |
| Density | 1.44g/cm3 | Boiling Point | 434.7ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.7ºC | |
| Name | ethyl 1-nitro-4-oxoquinolizine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 434.7ºC at 760 mmHg |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.21800 |
| Flash Point | 216.7ºC |
| Exact Mass | 262.05900 |
| PSA | 93.60000 |
| LogP | 1.90760 |
| Vapour Pressure | 9.26E-08mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | XUAURMWEQKYGBV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])c2ccccn2c1=O |
| HS Code | 2918300090 |
|---|
|
~%
ethyl 1-nitro-4... CAS#:1556-30-5 |
| Literature: Xu, Yi-Sheng; Zeng, Cheng-Chu; Jiao, Zi-Guo; Hu, Li-Ming; Zhong, Ru-Gang Molecules, 2009 , vol. 14, # 2 p. 868 - 883 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 1-nitro-4-oxo-4H-quinolizine-3-carboxylate |
| AR2981 |
| 1-Nitro-3-carbethoxy-4H-chinolizin-4-on |
| 1-nitro-4-oxo-4H-quinolizine-3-carboxylic acid ethyl ester |