3,5-Dibromo-1-methyl-4-nitro-1H-pyrazole structure
|
Common Name | 3,5-Dibromo-1-methyl-4-nitro-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 155600-99-0 | Molecular Weight | 284.893 | |
| Density | 2.5±0.1 g/cm3 | Boiling Point | 279.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C4H3Br2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.6±25.9 °C | |
| Name | 3,5-dibromo-1-methyl-4-nitropyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 2.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 279.1±35.0 °C at 760 mmHg |
| Molecular Formula | C4H3Br2N3O2 |
| Molecular Weight | 284.893 |
| Flash Point | 122.6±25.9 °C |
| Exact Mass | 282.859192 |
| PSA | 63.64000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.746 |
| InChIKey | PGMQVDHYFOWDLI-UHFFFAOYSA-N |
| SMILES | Cn1nc(Br)c([N+](=O)[O-])c1Br |
| HS Code | 2933199090 |
|---|
|
~72%
3,5-Dibromo-1-m... CAS#:155600-99-0 |
| Literature: Dahlgren, Richard Marc; Laidig, William David; Lim, Mu-ill; Murphy, Bryan Patrick; Zhang, Guiru Patent: US2009/282622 A1, 2009 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrazole, 3,5-dibromo-1-methyl-4-nitro- |
| 3,5-Dibromo-1-methyl-4-nitro-1H-pyrazole |
| 3,5-di-bromo-1-methyl-4-nitropyrazole |
| dibromomethylnitropyrazole |
| AC-0801 |