6-Bromo-5-chloro-2-oxo-5,6,6-trifluorohexane structure
|
Common Name | 6-Bromo-5-chloro-2-oxo-5,6,6-trifluorohexane | ||
|---|---|---|---|---|
| CAS Number | 155630-26-5 | Molecular Weight | 267.47100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H7BrClF3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-bromo-5-chloro-5,6,6-trifluorohexan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H7BrClF3O |
|---|---|
| Molecular Weight | 267.47100 |
| Exact Mass | 265.93200 |
| PSA | 17.07000 |
| LogP | 3.24790 |
| InChIKey | IPNZTHFBEOLUHV-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC(F)(Cl)C(F)(F)Br |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 6-Bromo-5-chloro-2-oxo-5,6,6-trifluorohexane |
| 6-Bromo-5-chloro-5,6,6-trifluoro-2-hexanone |