Carda-5,20(22)-dienolide,3-(acetyloxy)-14-hydroxy-19-oxo-, (3b)- (9CI) structure
|
Common Name | Carda-5,20(22)-dienolide,3-(acetyloxy)-14-hydroxy-19-oxo-, (3b)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 15571-07-0 | Molecular Weight | 428.51800 | |
| Density | 1.28g/cm3 | Boiling Point | 598.9ºC at 760mmHg | |
| Molecular Formula | C25H32O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.3ºC | |
| Name | [(3S,8R,9S,10S,13R,14S,17R)-10-formyl-14-hydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 598.9ºC at 760mmHg |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.51800 |
| Flash Point | 202.3ºC |
| Exact Mass | 428.22000 |
| PSA | 89.90000 |
| LogP | 3.27420 |
| Vapour Pressure | 7.69E-17mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | YXVAJWQGXKVWEN-PNALVPCQSA-N |
| SMILES | CC(=O)OC1CCC2(C=O)C(=CCC3C2CCC2(C)C(C4=CC(=O)OC4)CCC32O)C1 |
|
~%
Carda-5,20(22)-... CAS#:15571-07-0 |
| Literature: Jacobs; Collins Journal of Biological Chemistry, 1924 , vol. 59, p. 713,729 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Pachygenin-3-acetate |
| (3|A)-3-acetoxy-14-hydroxy-19-oxocarda-5,20(22)-dienolide |