1H-Indole-3-butanoicacid, methyl ester structure
|
Common Name | 1H-Indole-3-butanoicacid, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 15591-70-5 | Molecular Weight | 217.26400 | |
| Density | 1.157g/cm3 | Boiling Point | 382.3ºC at 760 mmHg | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185ºC | |
| Name | methyl 4-(1H-indol-3-yl)butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 382.3ºC at 760 mmHg |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26400 |
| Flash Point | 185ºC |
| Exact Mass | 217.11000 |
| PSA | 42.09000 |
| LogP | 2.66360 |
| Vapour Pressure | 4.79E-06mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | ZEJUFCOACOWDPP-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCc1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 1H-indole-3-butanoate |
| Indole-3-butyric acid,methyl ester |
| Methyl 4-(indol-3-yl)butyrate |
| 4-Indol-3-yl-buttersaeure-methylester |
| 4-indol-3-yl-butyric acid methyl ester |
| methyl indole-3-butylate |
| Methyl indole-3-butyrate |
| 1H-Indole-3-butanoic acid,methyl ester |
| methyl indole-3-butanoate |
| methyl 4-(indole-3)butyrate |