Cyclohexanecarboxamide,3-ethyl-2-oxo-3-phenyl- structure
|
Common Name | Cyclohexanecarboxamide,3-ethyl-2-oxo-3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 15595-81-0 | Molecular Weight | 245.31700 | |
| Density | 1.107g/cm3 | Boiling Point | 451.3ºC at 760mmHg | |
| Molecular Formula | C15H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.7ºC | |
| Name | 3-ethyl-2-oxo-3-phenylcyclohexane-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 451.3ºC at 760mmHg |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.31700 |
| Flash Point | 226.7ºC |
| Exact Mass | 245.14200 |
| PSA | 60.16000 |
| LogP | 2.88920 |
| Vapour Pressure | 2.46E-08mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | JRMIJQNSTPIEBO-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccccc2)CCCC(C(N)=O)C1=O |
|
~%
Cyclohexanecarb... CAS#:15595-81-0 |
| Literature: Kulp,S.S. Canadian Journal of Chemistry, 1967 , vol. 45, p. 1981 - 1986 |
|
~%
Cyclohexanecarb... CAS#:15595-81-0 |
| Literature: Kulp,S.S. Canadian Journal of Chemistry, 1967 , vol. 45, p. 1981 - 1986 |
|
~%
Cyclohexanecarb... CAS#:15595-81-0 |
| Literature: Kulp,S.S. Canadian Journal of Chemistry, 1967 , vol. 45, p. 1981 - 1986 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Aethyl-3-phenyl-2-oxo-cyclohexan-1-carbonsaeure-amid |