2-amino-1,1-diphenylheptan-1-ol structure
|
Common Name | 2-amino-1,1-diphenylheptan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 15599-37-8 | Molecular Weight | 283.40800 | |
| Density | 1.048g/cm3 | Boiling Point | 454ºC at 760mmHg | |
| Molecular Formula | C19H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.4ºC | |
| Name | 2-amino-1,1-diphenylheptan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.048g/cm3 |
|---|---|
| Boiling Point | 454ºC at 760mmHg |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.40800 |
| Flash Point | 228.4ºC |
| Exact Mass | 283.19400 |
| PSA | 46.25000 |
| LogP | 4.53040 |
| Vapour Pressure | 4.94E-09mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | ZVRZJTRBWTVKOJ-UHFFFAOYSA-N |
| SMILES | CCCCCC(N)C(O)(c1ccccc1)c1ccccc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Hexapradol [INN] |
| Hexapradolum |
| |A-phenyl-2-phenylheptanolamine |
| 2-Amino-1,1-diphenylheptamol |
| Hexapradol |
| 2-amino-1,1-diphenyl-heptan-1-ol |
| UNII-I71G9YBD89 |