5-(4-chlorophenyl)-9-methyl-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine structure
|
Common Name | 5-(4-chlorophenyl)-9-methyl-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 15599-44-7 | Molecular Weight | 305.80600 | |
| Density | 1.41g/cm3 | Boiling Point | 477.7ºC at 760mmHg | |
| Molecular Formula | C15H20ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.7ºC | |
| Name | 5-(4-chlorophenyl)-9-methyl-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 477.7ºC at 760mmHg |
| Molecular Formula | C15H20ClN5 |
| Molecular Weight | 305.80600 |
| Flash Point | 242.7ºC |
| Exact Mass | 305.14100 |
| PSA | 75.00000 |
| LogP | 4.03720 |
| Vapour Pressure | 2.75E-09mmHg at 25°C |
| Index of Refraction | 1.692 |
| InChIKey | VVMKZMXFFVPKJM-UHFFFAOYSA-N |
| SMILES | CC1CCC2(CC1)N=C(N)N=C(N)N2c1ccc(Cl)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| UNII-I4I0Q76VHJ |
| 11-(4-chlorophenyl)-3-methyl-7,9,11-triazaspiro[5.5]undeca-7,9-diene-8,10-diamine |
| Spirazine |
| 1-(4-Chlor-phenyl)-4,6-diamino-2,2-(3-methyl-pentamethylen)-1,2-dihydro-s-triazin |
| 2,4-Diamino-1-(4-chlor-phenyl)-6,6-(3-methyl-pentamethylen)-1,6-dihydro-1,3,5-triazin |
| UNII-WV516JUV0B |
| 5-(4-chloro-phenyl)-9-methyl-1,3,5-triaza-spiro[5.5]undeca-1,3-diene-2,4-diamine |