Symetine structure
|
Common Name | Symetine | ||
|---|---|---|---|---|
| CAS Number | 15599-45-8 | Molecular Weight | 468.71400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H48N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SymetineSymetine is an antiparasitic and antispirochete agent. |
| Name | 1,2-bis-{4-[(hexyl-methyl-amino)-methyl]-phenoxy}-ethane |
|---|---|
| Synonym | More Synonyms |
| Description | Symetine is an antiparasitic and antispirochete agent. |
|---|---|
| Related Catalog |
| Molecular Formula | C30H48N2O2 |
|---|---|
| Molecular Weight | 468.71400 |
| Exact Mass | 468.37200 |
| PSA | 24.94000 |
| LogP | 7.16860 |
| InChIKey | XVGLWUPIJXJSOB-UHFFFAOYSA-N |
| SMILES | CCCCCCN(C)Cc1ccc(OCCOc2ccc(CN(C)CCCCCC)cc2)cc1 |
| Storage condition | 2-8℃ |
| Hexyl-[4-(2-{4-[(hexyl-methyl-amino)-methyl]-phenoxy}-ethoxy)-benzyl]-methyl-amine |
| 1,2-Bis-{4-[(hexyl-methyl-amino)-methyl]-phenoxy}-aethan |
| Symetine |