7-(3-oxobutan-2-yloxy)chromen-2-one structure
|
Common Name | 7-(3-oxobutan-2-yloxy)chromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 156006-08-5 | Molecular Weight | 232.23200 | |
| Density | 1.234g/cm3 | Boiling Point | 404.1ºC at 760 mmHg | |
| Molecular Formula | C13H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.1ºC | |
| Name | 7-(3-oxobutan-2-yloxy)chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 404.1ºC at 760 mmHg |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23200 |
| Flash Point | 182.1ºC |
| Exact Mass | 232.07400 |
| PSA | 56.51000 |
| LogP | 2.14930 |
| Vapour Pressure | 9.71E-07mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | UHCVPUSBZDLSQF-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C)Oc1ccc2ccc(=O)oc2c1 |
| HS Code | 2932209090 |
|---|
|
~99%
7-(3-oxobutan-2... CAS#:156006-08-5 |
| Literature: Sicard, Renaud; Chen, Lu S.; Marsaioli, Anita J.; Reymond, Jean-Louis Advanced Synthesis and Catalysis, 2005 , vol. 347, # 7-8 p. 1041 - 1050 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-(1-methylacetonyloxy)coumarin |
| 7-(1-methyl-2-oxopropoxy)-chromen-2-one |