2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid,3-(diethoxymethyl)-4-octoxyaniline structure
|
Common Name | 2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid,3-(diethoxymethyl)-4-octoxyaniline | ||
|---|---|---|---|---|
| CAS Number | 15607-50-8 | Molecular Weight | 709.82200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H51NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid,3-(diethoxymethyl)-4-octoxyaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C39H51NO11 |
|---|---|
| Molecular Weight | 709.82200 |
| Exact Mass | 709.34600 |
| PSA | 180.91000 |
| LogP | 7.88450 |
| Vapour Pressure | 1.47E-16mmHg at 25°C |
| InChIKey | KZDIPJKKMVOBPU-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOc1ccc(N)cc1C(OCC)OCC.Cc1ccc(C(=O)OC(C(=O)O)C(OC(=O)c2ccc(C)cc2)C(=O)O)cc1 |
| Benzaldehyde,5-amino-2-(octyloxy)-,diethyl acetal,compd. with tartaric acid di-p-toluate |
| 2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid |
| Tartaric acid,di-p-toluate,compd. with 5-amino-2-(octyloxy)benzaldehyde diethyl acetal |
| 3-(diethoxymethyl)-4-octoxyaniline |
| M &B 6064 |