5,6-Dihydro-4,6-dimethyl-2-[3-(1-pyrrolidinyl)propyl]-4H-1,3,4-thiadiazine structure
|
Common Name | 5,6-Dihydro-4,6-dimethyl-2-[3-(1-pyrrolidinyl)propyl]-4H-1,3,4-thiadiazine | ||
|---|---|---|---|---|
| CAS Number | 15620-49-2 | Molecular Weight | 241.39600 | |
| Density | 1.16g/cm3 | Boiling Point | 351.2ºC at 760mmHg | |
| Molecular Formula | C12H23N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.2ºC | |
| Name | 4,6-dimethyl-2-(3-pyrrolidin-1-ylpropyl)-5,6-dihydro-1,3,4-thiadiazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 351.2ºC at 760mmHg |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.39600 |
| Flash Point | 166.2ºC |
| Exact Mass | 241.16100 |
| PSA | 44.14000 |
| LogP | 1.55440 |
| Vapour Pressure | 4.19E-05mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | SEJFSLCYPSGSFD-UHFFFAOYSA-N |
| SMILES | CC1CN(C)N=C(CCCN2CCCC2)S1 |
| HS Code | 2934999090 |
|---|
|
~%
5,6-Dihydro-4,6... CAS#:15620-49-2 |
| Literature: Trepanier; Krieger; Mennear; Eble Journal of medicinal chemistry, 1967 , vol. 10, # 6 p. 1085 - 1087 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,6-Dihydro-4,6-dimethyl-2-(3-pyrrolidinylpropyl)-4H-1,3,4-thiadiazine |
| 4H-1,3,4-Thiadiazine,5,6-dihydro-4,6-dimethyl-2-(3-pyrrolidinylpropyl) |
| 4,6-dimethyl-2-(3-pyrrolidin-1-yl-propyl)-5,6-dihydro-4H-[1,3,4]thiadiazine |